CAS 1405343-24-9 appears in our catalog under these names: 1-(3-Methylbenzyl)-1H-pyrazolo(3,4-d)pyrimidin-4-amine, 95%, 1-(3-Methylbenzyl)-1H-pyrazolo(3,4-d)pyrimidin-4-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
1-[(3-methylphenyl)methyl]pyrazolo[3,4-d]pyrimidin-4-amine (CAS 1405343-24-9) is a chemical compound with the molecular formula C13H13N5 and a molecular weight of 239.28 g/mol. IUPAC name: 1-[(3-methylphenyl)methyl]pyrazolo[3,4-d]pyrimidin-4-amine. InChIKey: ZUHJEVUISWSQMZ-UHFFFAOYSA-N.
| Molecular formula | C13H13N5 |
|---|---|
| Molecular weight | 239.28 g/mol |
| IUPAC name | 1-[(3-methylphenyl)methyl]pyrazolo[3,4-d]pyrimidin-4-amine |
| InChIKey | ZUHJEVUISWSQMZ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)CN2C3=NC=NC(=C3C=N2)N |
Computed by PubChem (NCBI)