CAS 108810-87-3 is the registry number for N-Methyl-3-(3-methyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)aniline, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
N-methyl-3-(3-methyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)aniline (CAS 108810-87-3) is a chemical compound with the molecular formula C13H13N5 and a molecular weight of 239.28 g/mol. IUPAC name: N-methyl-3-(3-methyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)aniline. InChIKey: TZRQKMIWDSAQMS-UHFFFAOYSA-N.
| Molecular formula | C13H13N5 |
|---|---|
| Molecular weight | 239.28 g/mol |
| IUPAC name | N-methyl-3-(3-methyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)aniline |
| InChIKey | TZRQKMIWDSAQMS-UHFFFAOYSA-N |
| SMILES | CC1=NN=C2N1N=C(C=C2)C3=CC(=CC=C3)NC |
Computed by PubChem (NCBI)