cas: 214360-59-5 — see every product listed under this CAS number, including other names
2,6-DIMETHOXY-3-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PYRIDINE, 98%, 98% (CAS 214360-59-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114G62-100mg |
| cas | 214360-59-5 |
| size | 100mg |
| availability | 100g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 146.00 Pln | |
| Chemat | 250mg | 198.80 Pln | |
| Chemat | 1g | 338.00 Pln | |
| Chemat | 5g | 1029.20 Pln | |
| Chemat | 10g | 1442.00 Pln | |
| Chemat | 25g | 2613.20 Pln | |
| Chemat | 50g | 3506.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2,6-dimethoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 214360-59-5) is a chemical compound with the molecular formula C13H20BNO4 and a molecular weight of 265.12 g/mol. IUPAC name: 2,6-dimethoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: VZGDCNFVMWRPOW-UHFFFAOYSA-N.
| Molecular formula | C13H20BNO4 |
|---|---|
| Molecular weight | 265.12 g/mol |
| IUPAC name | 2,6-dimethoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | VZGDCNFVMWRPOW-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(N=C(C=C2)OC)OC |
Computed by PubChem (NCBI)