cas: 91590-90-8 — see every product listed under this CAS number, including other names
2,6-Dibromo-4-fluorobenzoic acid, 97% (CAS 91590-90-8) is a chemical reagent available from Chemat. Available pack sizes: 25g, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A649728-25g |
| cas | 91590-90-8 |
| size | 25g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 25g | 17249.89 Pln | |
| AmBeed | 10g | 8786.89 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
2,6-dibromo-4-fluorobenzoic acid (CAS 91590-90-8) is a chemical compound with the molecular formula C7H3Br2FO2 and a molecular weight of 297.90 g/mol. IUPAC name: 2,6-dibromo-4-fluorobenzoic acid. InChIKey: ZYBAQKCBAGCGGY-UHFFFAOYSA-N.
| Molecular formula | C7H3Br2FO2 |
|---|---|
| Molecular weight | 297.90 g/mol |
| IUPAC name | 2,6-dibromo-4-fluorobenzoic acid |
| InChIKey | ZYBAQKCBAGCGGY-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Br)C(=O)O)Br)F |
Computed by PubChem (NCBI)