Products 1805122-82-0

CAS 1805122-82-0 is the registry number for 2,4-Dibromo-3-fluorobenzoic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.

2,4-dibromo-3-fluorobenzoic acid (CAS 1805122-82-0) is a chemical compound with the molecular formula C7H3Br2FO2 and a molecular weight of 297.90 g/mol. IUPAC name: 2,4-dibromo-3-fluorobenzoic acid. InChIKey: GWZZRCMWJPCRKP-UHFFFAOYSA-N.

Identity
Molecular formulaC7H3Br2FO2
Molecular weight297.90 g/mol
IUPAC name2,4-dibromo-3-fluorobenzoic acid
InChIKeyGWZZRCMWJPCRKP-UHFFFAOYSA-N
SMILESC1=CC(=C(C(=C1C(=O)O)Br)F)Br

Computed by PubChem (NCBI)