Products 402-87-9

CAS 402-87-9 appears in our catalog under these names: 3,5-Dibromo-4-fluorobenzoic acid, 95%, 3,5-Dibromo-4-fluorobenzoic acid 95%, 3,5-Dibromo-4-fluorobenzoic Acid, 95%, 95%, 3,5-DIBROMO-4-FLUOROBENZOIC ACID, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 100mg, 10g.

Structural formula: {0} (CAS {1})

3,5-dibromo-4-fluorobenzoic acid (CAS 402-87-9) is a chemical compound with the molecular formula C7H3Br2FO2 and a molecular weight of 297.90 g/mol. IUPAC name: 3,5-dibromo-4-fluorobenzoic acid. InChIKey: URZMIPMWYXHUMI-UHFFFAOYSA-N.

Identity
Molecular formulaC7H3Br2FO2
Molecular weight297.90 g/mol
IUPAC name3,5-dibromo-4-fluorobenzoic acid
InChIKeyURZMIPMWYXHUMI-UHFFFAOYSA-N
SMILESC1=C(C=C(C(=C1Br)F)Br)C(=O)O

Computed by PubChem (NCBI)