CAS 402-87-9 appears in our catalog under these names: 3,5-Dibromo-4-fluorobenzoic acid, 95%, 3,5-Dibromo-4-fluorobenzoic acid 95%, 3,5-Dibromo-4-fluorobenzoic Acid, 95%, 95%, 3,5-DIBROMO-4-FLUOROBENZOIC ACID, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 100mg, 10g.
3,5-dibromo-4-fluorobenzoic acid (CAS 402-87-9) is a chemical compound with the molecular formula C7H3Br2FO2 and a molecular weight of 297.90 g/mol. IUPAC name: 3,5-dibromo-4-fluorobenzoic acid. InChIKey: URZMIPMWYXHUMI-UHFFFAOYSA-N.
| Molecular formula | C7H3Br2FO2 |
|---|---|
| Molecular weight | 297.90 g/mol |
| IUPAC name | 3,5-dibromo-4-fluorobenzoic acid |
| InChIKey | URZMIPMWYXHUMI-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Br)F)Br)C(=O)O |
Computed by PubChem (NCBI)