CAS 1214352-42-7 appears in our catalog under these names: 3,6-Dibromo-2-fluorobenzoic acid, 95%, 3,6-Dibromo-2-fluorobenzoic acid, 95+%, 3,6-Dibromo-2-fluorobenzoic acid, 3,6-Dibromo-2-fluorobenzoic acid 95+%, 3,6-Dibromo-2-fluorobenzoic acid, 95+%, 95+%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 25g, 1g, 250mg, 0,5g.
3,6-dibromo-2-fluorobenzoic acid (CAS 1214352-42-7) is a chemical compound with the molecular formula C7H3Br2FO2 and a molecular weight of 297.90 g/mol. IUPAC name: 3,6-dibromo-2-fluorobenzoic acid. InChIKey: XUWXFNAXMCSSJT-UHFFFAOYSA-N.
| Molecular formula | C7H3Br2FO2 |
|---|---|
| Molecular weight | 297.90 g/mol |
| IUPAC name | 3,6-dibromo-2-fluorobenzoic acid |
| InChIKey | XUWXFNAXMCSSJT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1Br)C(=O)O)F)Br |
Computed by PubChem (NCBI)