Products 2426639-91-8
CAS 2426639-91-8 is the registry number for 3,5-Dibromo-2-fluoro-4-hydroxybenzaldehyde, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
3,5-dibromo-2-fluoro-4-hydroxybenzaldehyde (CAS 2426639-91-8) is a chemical compound with the molecular formula C7H3Br2FO2 and a molecular weight of 297.90 g/mol. IUPAC name: 3,5-dibromo-2-fluoro-4-hydroxybenzaldehyde. InChIKey: VUVZWDHWJRDZMJ-UHFFFAOYSA-N.
| Molecular formula | C7H3Br2FO2 |
|---|---|
| Molecular weight | 297.90 g/mol |
| IUPAC name | 3,5-dibromo-2-fluoro-4-hydroxybenzaldehyde |
| InChIKey | VUVZWDHWJRDZMJ-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Br)O)Br)F)C=O |
Computed by PubChem (NCBI)