Products 183065-69-2

CAS 183065-69-2 appears in our catalog under these names: 2,4-Dibromo-6-fluorobenzoic acid, 98%, 2,4-Dibromo-6-fluorobenzoic acid, 95%, 2,4-Dibromo-6-fluorobenzoic acid 95%, 2,4-Dibromo-6-fluorobenzoic acid, 98%, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 25g, 1g, 250mg, 100mg, 500mg.

Structural formula: {0} (CAS {1})

2,4-dibromo-6-fluorobenzoic acid (CAS 183065-69-2) is a chemical compound with the molecular formula C7H3Br2FO2 and a molecular weight of 297.90 g/mol. IUPAC name: 2,4-dibromo-6-fluorobenzoic acid. InChIKey: RAGHPDYPAYDOJH-UHFFFAOYSA-N.

Identity
Molecular formulaC7H3Br2FO2
Molecular weight297.90 g/mol
IUPAC name2,4-dibromo-6-fluorobenzoic acid
InChIKeyRAGHPDYPAYDOJH-UHFFFAOYSA-N
SMILESC1=C(C=C(C(=C1F)C(=O)O)Br)Br

Computed by PubChem (NCBI)