cas: 2484889-02-1 — see every product listed under this CAS number, including other names
2,6-Dibromo-4-isopropylbenzoic acid (CAS 2484889-02-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F629411-1G |
| cas | 2484889-02-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 1611.95 Pln | |
| Fluorochem | 5g | 4683.79 Pln |
| delivery time | 3-4 weeks |
|---|
2,6-dibromo-4-propan-2-ylbenzoic acid (CAS 2484889-02-1) is a chemical compound with the molecular formula C10H10Br2O2 and a molecular weight of 321.99 g/mol. IUPAC name: 2,6-dibromo-4-propan-2-ylbenzoic acid. InChIKey: PMEJGPKKBPTSOP-UHFFFAOYSA-N.
| Molecular formula | C10H10Br2O2 |
|---|---|
| Molecular weight | 321.99 g/mol |
| IUPAC name | 2,6-dibromo-4-propan-2-ylbenzoic acid |
| InChIKey | PMEJGPKKBPTSOP-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC(=C(C(=C1)Br)C(=O)O)Br |
Computed by PubChem (NCBI)