cas: 88174-23-6 — see every product listed under this CAS number, including other names
2,6-Dibromo-4-methylbenzaldehyde, 95%, 95% (CAS 88174-23-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch115DSS-100mg |
| cas | 88174-23-6 |
| size | 100mg |
| availability | 7g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 256.40 Pln | |
| Chemat | 250mg | 390.80 Pln | |
| Chemat | 1g | 942.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2,6-dibromo-4-methylbenzaldehyde (CAS 88174-23-6) is a chemical compound with the molecular formula C8H6Br2O and a molecular weight of 277.94 g/mol. IUPAC name: 2,6-dibromo-4-methylbenzaldehyde. InChIKey: DQKYOHFYBQVJTH-UHFFFAOYSA-N.
| Molecular formula | C8H6Br2O |
|---|---|
| Molecular weight | 277.94 g/mol |
| IUPAC name | 2,6-dibromo-4-methylbenzaldehyde |
| InChIKey | DQKYOHFYBQVJTH-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)Br)C=O)Br |
Computed by PubChem (NCBI)