CAS 88174-23-6 appears in our catalog under these names: 2,6-Dibromo-4-methylbenzaldehyde, 95%, 2,6-Dibromo-4-methylbenzaldehyde, 95%, 95%, 2,6-Dibromo-4-methylbenzaldehyde, 95+%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 10g, 5g, 25g, 1g, 250mg, 100mg.
2,6-dibromo-4-methylbenzaldehyde (CAS 88174-23-6) is a chemical compound with the molecular formula C8H6Br2O and a molecular weight of 277.94 g/mol. IUPAC name: 2,6-dibromo-4-methylbenzaldehyde. InChIKey: DQKYOHFYBQVJTH-UHFFFAOYSA-N.
| Molecular formula | C8H6Br2O |
|---|---|
| Molecular weight | 277.94 g/mol |
| IUPAC name | 2,6-dibromo-4-methylbenzaldehyde |
| InChIKey | DQKYOHFYBQVJTH-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)Br)C=O)Br |
Computed by PubChem (NCBI)