CAS 32937-55-6 appears in our catalog under these names: 2',5'-Dibromoacetophenone, 97%, 1-(2,5-Dibromophenyl)ethanone, 95-<97%, 1-(2,5-Dibromophenyl)ethanone, ≥97-<99%, 1-(2,5-Dibromophenyl)ethanone, 1-(2,5-Dibromophenyl)Ethanone, 97%, 97%. Offered by: Combi-blocks, Hoffman Fine Chemicals, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 25g, 5g, 1g, 10g, 50g, 100g, 200g.
1-(2,5-dibromophenyl)ethanone (CAS 32937-55-6) is a chemical compound with the molecular formula C8H6Br2O and a molecular weight of 277.94 g/mol. IUPAC name: 1-(2,5-dibromophenyl)ethanone. InChIKey: QFXROJNBTPMHSS-UHFFFAOYSA-N.
| Molecular formula | C8H6Br2O |
|---|---|
| Molecular weight | 277.94 g/mol |
| IUPAC name | 1-(2,5-dibromophenyl)ethanone |
| InChIKey | QFXROJNBTPMHSS-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C=CC(=C1)Br)Br |
Computed by PubChem (NCBI)