CAS 49851-55-0 appears in our catalog under these names: 2-Bromophenacyl bromide, 95%, 2,2'-Dibromoacetophenone, 2–Bromophenacyl Bromide, 2-Bromophenacyl Bromide, >95.0%(GC), 2-Bromo-1-(2-bromophenyl)ethanone 95%. Offered by: Combi-blocks, TRC, GLPBio, TCI, Ambeed. Available pack sizes: 25g, 1g, 5g, 10g, 250mg, 100g, 100mg.
2-bromo-1-(2-bromophenyl)ethanone (CAS 49851-55-0) is a chemical compound with the molecular formula C8H6Br2O and a molecular weight of 277.94 g/mol. IUPAC name: 2-bromo-1-(2-bromophenyl)ethanone. InChIKey: LAXPJIJQTHJGCK-UHFFFAOYSA-N.
| Molecular formula | C8H6Br2O |
|---|---|
| Molecular weight | 277.94 g/mol |
| IUPAC name | 2-bromo-1-(2-bromophenyl)ethanone |
| InChIKey | LAXPJIJQTHJGCK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)CBr)Br |
Computed by PubChem (NCBI)