CAS 18523-22-3 appears in our catalog under these names: 3-Bromophenacyl Bromide, 3-Bromophenacyl bromide, 97%, 2-Bromo-3'-bromoacetophenone, 3-Bromophenacyl bromide, 98%, 3-Bromophenacyl Bromide, >98.0%(T). Offered by: TRC, Combi-blocks, Biosynth, Fluorochem, TCI. Available pack sizes: 1g, 250mg, 5g, 100g, 25g, 10g, 500g.
2-bromo-1-(3-bromophenyl)ethanone (CAS 18523-22-3) is a chemical compound with the molecular formula C8H6Br2O and a molecular weight of 277.94 g/mol. IUPAC name: 2-bromo-1-(3-bromophenyl)ethanone. InChIKey: MZBXSQBQPJWECM-UHFFFAOYSA-N.
| Molecular formula | C8H6Br2O |
|---|---|
| Molecular weight | 277.94 g/mol |
| IUPAC name | 2-bromo-1-(3-bromophenyl)ethanone |
| InChIKey | MZBXSQBQPJWECM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)C(=O)CBr |
Computed by PubChem (NCBI)