CAS 33243-33-3 appears in our catalog under these names: 2',4'-Dibromoacetophenone, 95%, 2',4'–Dibromoacetophenone, 2',4'-Dibromoacetophenone, 2',4'-Dibromoacetophenone 95%, 2',4'-Dibromoacetophenone, 98%, 98%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 10g, 5g, 25g, 1g, 250mg, 50g, 100g, 100mg.
1-(2,4-dibromophenyl)ethanone (CAS 33243-33-3) is a chemical compound with the molecular formula C8H6Br2O and a molecular weight of 277.94 g/mol. IUPAC name: 1-(2,4-dibromophenyl)ethanone. InChIKey: PFNFQYGPUFVXPB-UHFFFAOYSA-N.
| Molecular formula | C8H6Br2O |
|---|---|
| Molecular weight | 277.94 g/mol |
| IUPAC name | 1-(2,4-dibromophenyl)ethanone |
| InChIKey | PFNFQYGPUFVXPB-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C=C(C=C1)Br)Br |
Computed by PubChem (NCBI)