cas: 827-94-1 — see every product listed under this CAS number, including other names
2,6-Dibromo-4-nitroaniline 98% (CAS 827-94-1) is a chemical reagent available from Chemat. Available pack sizes: 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A638442-100g |
| cas | 827-94-1 |
| size | 100g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100g | 186.81 Pln | |
| Ambeed | 500g | 381.50 Pln | |
| Ambeed | 1000g | 587.31 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A638442 |
2,6-dibromo-4-nitroaniline (CAS 827-94-1) is a chemical compound with the molecular formula C6H4Br2N2O2 and a molecular weight of 295.92 g/mol. IUPAC name: 2,6-dibromo-4-nitroaniline. InChIKey: YMZIFDLWYUSZCC-UHFFFAOYSA-N.
| Molecular formula | C6H4Br2N2O2 |
|---|---|
| Molecular weight | 295.92 g/mol |
| IUPAC name | 2,6-dibromo-4-nitroaniline |
| InChIKey | YMZIFDLWYUSZCC-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Br)N)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)