cas: 827-94-1 — see every product listed under this CAS number, including other names
2,6-Dibromo-4-nitroaniline, >98.0%(GC) (CAS 827-94-1) is a chemical reagent available from Chemat. Available pack sizes: 25g, 500g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | D2414-25G |
| cas | 827-94-1 |
| size | 25g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 25g | 231.44 Pln | |
| TCI | 500g | 1962.31 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC) |
2,6-dibromo-4-nitroaniline (CAS 827-94-1) is a chemical compound with the molecular formula C6H4Br2N2O2 and a molecular weight of 295.92 g/mol. IUPAC name: 2,6-dibromo-4-nitroaniline. InChIKey: YMZIFDLWYUSZCC-UHFFFAOYSA-N.
| Molecular formula | C6H4Br2N2O2 |
|---|---|
| Molecular weight | 295.92 g/mol |
| IUPAC name | 2,6-dibromo-4-nitroaniline |
| InChIKey | YMZIFDLWYUSZCC-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Br)N)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)