cas: 827-94-1 — see every product listed under this CAS number, including other names
2,6-Dibromo-4-nitroaniline, 95% (CAS 827-94-1) is a chemical reagent available from Chemat. Available pack sizes: 25g, 500g, 1kg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F237150-25G |
| cas | 827-94-1 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 25g | 96.86 Pln | |
| Fluorochem | 500g | 195.78 Pln | |
| Fluorochem | 1kg | 331.15 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
2,6-dibromo-4-nitroaniline (CAS 827-94-1) is a chemical compound with the molecular formula C6H4Br2N2O2 and a molecular weight of 295.92 g/mol. IUPAC name: 2,6-dibromo-4-nitroaniline. InChIKey: YMZIFDLWYUSZCC-UHFFFAOYSA-N.
| Molecular formula | C6H4Br2N2O2 |
|---|---|
| Molecular weight | 295.92 g/mol |
| IUPAC name | 2,6-dibromo-4-nitroaniline |
| InChIKey | YMZIFDLWYUSZCC-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Br)N)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)