cas: 1428234-65-4 — see every product listed under this CAS number, including other names
2,6-Dichloro-3-(pyrolidin-1-ylmethyl)pyridine (CAS 1428234-65-4) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F632140-1G |
| cas | 1428234-65-4 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 5792.77 Pln |
| delivery time | 3-4 weeks |
|---|
2,6-dichloro-3-(pyrrolidin-1-ylmethyl)pyridine (CAS 1428234-65-4) is a chemical compound with the molecular formula C10H12Cl2N2 and a molecular weight of 231.12 g/mol. IUPAC name: 2,6-dichloro-3-(pyrrolidin-1-ylmethyl)pyridine. InChIKey: UVOKFOBKTMCPNH-UHFFFAOYSA-N.
| Molecular formula | C10H12Cl2N2 |
|---|---|
| Molecular weight | 231.12 g/mol |
| IUPAC name | 2,6-dichloro-3-(pyrrolidin-1-ylmethyl)pyridine |
| InChIKey | UVOKFOBKTMCPNH-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)CC2=C(N=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)