CAS 914348-91-7 is the registry number for 2-(2,5-Dichlorophenyl)piperazine, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
2-(2,5-dichlorophenyl)piperazine (CAS 914348-91-7) is a chemical compound with the molecular formula C10H12Cl2N2 and a molecular weight of 231.12 g/mol. IUPAC name: 2-(2,5-dichlorophenyl)piperazine. InChIKey: PAZPHGORPPQSTL-UHFFFAOYSA-N.
| Molecular formula | C10H12Cl2N2 |
|---|---|
| Molecular weight | 231.12 g/mol |
| IUPAC name | 2-(2,5-dichlorophenyl)piperazine |
| InChIKey | PAZPHGORPPQSTL-UHFFFAOYSA-N |
| SMILES | C1CNC(CN1)C2=C(C=CC(=C2)Cl)Cl |
Computed by PubChem (NCBI)