CAS 878778-84-8 appears in our catalog under these names: Quinolin-4-yl-methylamine dihydrochloride, 95%, Quinolin-4-ylmethanamine dihydrochloride, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg.
Quinolin-4-ylmethanamine;dihydrochloride (CAS 878778-84-8) is a chemical compound with the molecular formula C10H12Cl2N2 and a molecular weight of 231.12 g/mol. IUPAC name: quinolin-4-ylmethanamine;dihydrochloride. InChIKey: MWFIZNMXSPLSJY-UHFFFAOYSA-N.
| Molecular formula | C10H12Cl2N2 |
|---|---|
| Molecular weight | 231.12 g/mol |
| IUPAC name | quinolin-4-ylmethanamine;dihydrochloride |
| InChIKey | MWFIZNMXSPLSJY-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC=N2)CN.Cl.Cl |
Computed by PubChem (NCBI)