Products 1296950-60-1
CAS 1296950-60-1 appears in our catalog under these names: 3-Amino-7-methylquinoline dihydrochloride, 95%, 7-Methylquinolin-3-amine dihydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
7-methylquinolin-3-amine;dihydrochloride (CAS 1296950-60-1) is a chemical compound with the molecular formula C10H12Cl2N2 and a molecular weight of 231.12 g/mol. IUPAC name: 7-methylquinolin-3-amine;dihydrochloride. InChIKey: KEYDZGNQMAORQV-UHFFFAOYSA-N.
| Molecular formula | C10H12Cl2N2 |
|---|---|
| Molecular weight | 231.12 g/mol |
| IUPAC name | 7-methylquinolin-3-amine;dihydrochloride |
| InChIKey | KEYDZGNQMAORQV-UHFFFAOYSA-N |
| SMILES | CC1=CC2=NC=C(C=C2C=C1)N.Cl.Cl |
Computed by PubChem (NCBI)