CAS 81868-13-5 appears in our catalog under these names: 7-Chlorotryptamine hydrochloride, 95%, 7-Chlorotryptamine Hydrochloride, 2-(7-Chloro-1H-indol-3-yl)ethanamine hydrochloride, 2-(7-Chloro-1H-indol-3-yl)ethanamine hyd, rochloride, 100 mg, 2-(7-Chloro-1H-indol-3-yl)ethanamine hyd, rochloride, 250 mg. Offered by: Combi-blocks, TRC, Biosynth, Roth. Available pack sizes: 1g, 250mg, 500mg, 100mg.
2-(7-chloro-1H-indol-3-yl)ethanamine;hydrochloride (CAS 81868-13-5) is a chemical compound with the molecular formula C10H12Cl2N2 and a molecular weight of 231.12 g/mol. IUPAC name: 2-(7-chloro-1H-indol-3-yl)ethanamine;hydrochloride. InChIKey: TXIDBOZNQRWNOE-UHFFFAOYSA-N.
| Molecular formula | C10H12Cl2N2 |
|---|---|
| Molecular weight | 231.12 g/mol |
| IUPAC name | 2-(7-chloro-1H-indol-3-yl)ethanamine;hydrochloride |
| InChIKey | TXIDBOZNQRWNOE-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Cl)NC=C2CCN.Cl |
Computed by PubChem (NCBI)