CAS 19382-38-8 appears in our catalog under these names: 1-Isoquinolin-1-ylmethanamine dihydrochloride, 95%, Isoquinolin–1–ylmethanamine dihydrochloride, 1-Isoquinolin-1-ylmethanamine dihydrochloride, Isoquinolin-1-ylmethanamine dihydrochloride 95%, Isoquinolin-1-ylmethanamine dihydrochloride, 97%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100mg, 500mg, 2000mg, 1000mg, 2.5g.
Isoquinolin-1-ylmethanamine;dihydrochloride (CAS 19382-38-8) is a chemical compound with the molecular formula C10H12Cl2N2 and a molecular weight of 231.12 g/mol. IUPAC name: isoquinolin-1-ylmethanamine;dihydrochloride. InChIKey: NSZXYJPWXMGVFU-UHFFFAOYSA-N.
| Molecular formula | C10H12Cl2N2 |
|---|---|
| Molecular weight | 231.12 g/mol |
| IUPAC name | isoquinolin-1-ylmethanamine;dihydrochloride |
| InChIKey | NSZXYJPWXMGVFU-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CN=C2CN.Cl.Cl |
Computed by PubChem (NCBI)