cas: 185423-26-1 — see every product listed under this CAS number, including other names
2,6-Dichloro-3-hydroxypyridine-4-carboxaldehyde, 95%, 95% (CAS 185423-26-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch118TGJ-100mg |
| cas | 185423-26-1 |
| size | 100mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 198.80 Pln | |
| Chemat | 250mg | 294.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2,6-dichloro-3-hydroxypyridine-4-carbaldehyde (CAS 185423-26-1) is a chemical compound with the molecular formula C6H3Cl2NO2 and a molecular weight of 192.00 g/mol. IUPAC name: 2,6-dichloro-3-hydroxypyridine-4-carbaldehyde. InChIKey: HPCFBIVANWQGDD-UHFFFAOYSA-N.
| Molecular formula | C6H3Cl2NO2 |
|---|---|
| Molecular weight | 192.00 g/mol |
| IUPAC name | 2,6-dichloro-3-hydroxypyridine-4-carbaldehyde |
| InChIKey | HPCFBIVANWQGDD-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(N=C1Cl)Cl)O)C=O |
Computed by PubChem (NCBI)