CAS 959578-03-1 appears in our catalog under these names: 3,4-Dichloropicolinic acid, 95%, 3,4–Dichloropyridine–2–carboxylic Acid, 3,4-Dichloropicolinic acid, 3,4-Dichloropicolinic acid, >97%, >97%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 100mg, 0,5g, 10g.
3,4-dichloropyridine-2-carboxylic acid (CAS 959578-03-1) is a chemical compound with the molecular formula C6H3Cl2NO2 and a molecular weight of 192.00 g/mol. IUPAC name: 3,4-dichloropyridine-2-carboxylic acid. InChIKey: AFZMKBLOQNTBOT-UHFFFAOYSA-N.
| Molecular formula | C6H3Cl2NO2 |
|---|---|
| Molecular weight | 192.00 g/mol |
| IUPAC name | 3,4-dichloropyridine-2-carboxylic acid |
| InChIKey | AFZMKBLOQNTBOT-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C(=C1Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)