CAS 601-88-7 appears in our catalog under these names: 1,3-Dichloro-2-nitrobenzene, >95% (HPLC), 2,6-Dichloronitrobenzene, 1,3–Dichloro–2–nitrobenzene, 1,3-Dichloro-2-nitrobenzene, >98.0%(GC), 1,3-Dichloro-2-nitrobenzene 98%. Offered by: TRC, Dr. Ehrenstorfer, GLPBio, Biosynth, TCI. Available pack sizes: 100g, 1g, 5g, 100mg, 500g, 250g, 25g, 10g.
1,3-dichloro-2-nitrobenzene (CAS 601-88-7) is a chemical compound with the molecular formula C6H3Cl2NO2 and a molecular weight of 192.00 g/mol. IUPAC name: 1,3-dichloro-2-nitrobenzene. InChIKey: VITSNECNFNNVQB-UHFFFAOYSA-N.
| Molecular formula | C6H3Cl2NO2 |
|---|---|
| Molecular weight | 192.00 g/mol |
| IUPAC name | 1,3-dichloro-2-nitrobenzene |
| InChIKey | VITSNECNFNNVQB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)