Products 152420-76-3
CAS 152420-76-3 is the registry number for 3,5-Dichloro-1h-pyrrole-2,4-dicarbaldehyde, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
3,5-dichloro-1H-pyrrole-2,4-dicarbaldehyde (CAS 152420-76-3) is a chemical compound with the molecular formula C6H3Cl2NO2 and a molecular weight of 192.00 g/mol. IUPAC name: 3,5-dichloro-1H-pyrrole-2,4-dicarbaldehyde. InChIKey: WXAGUHKVWPKZMQ-UHFFFAOYSA-N.
| Molecular formula | C6H3Cl2NO2 |
|---|---|
| Molecular weight | 192.00 g/mol |
| IUPAC name | 3,5-dichloro-1H-pyrrole-2,4-dicarbaldehyde |
| InChIKey | WXAGUHKVWPKZMQ-UHFFFAOYSA-N |
| SMILES | C(=O)C1=C(NC(=C1Cl)C=O)Cl |
Computed by PubChem (NCBI)