CAS 618-62-2 appears in our catalog under these names: 3,5-Dichloronitrobenzene, 95%, 1,3-Dichloro-5-nitrobenzene, 98%, 3,5–Dichloronitrobenzene, 3,5-Dichloronitrobenzene, >99.0%(GC), 3,5-Dichloronitrobenzene. Offered by: Combi-blocks, Chemat Brand, GLPBio, TCI, HPC Standards. Available pack sizes: 25g, 5g, 1g, on request, 1x250mg, 100g.
1,3-dichloro-5-nitrobenzene (CAS 618-62-2) is a chemical compound with the molecular formula C6H3Cl2NO2 and a molecular weight of 192.00 g/mol. IUPAC name: 1,3-dichloro-5-nitrobenzene. InChIKey: RNABGKOKSBUFHW-UHFFFAOYSA-N.
| Molecular formula | C6H3Cl2NO2 |
|---|---|
| Molecular weight | 192.00 g/mol |
| IUPAC name | 1,3-dichloro-5-nitrobenzene |
| InChIKey | RNABGKOKSBUFHW-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1Cl)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)