CAS 88912-26-9 appears in our catalog under these names: 2,5-Dichloroisonicotinic acid, 95%, 2,5–Dichloropyridine–4–carboxylic acid, 2,5-Dichloroisonicotinic Acid, >98.0%(T)(GC), 2,5-Dichloroisonicotinic acid 98%, 2,5-Dichloroisonicotinic acid, 98%, 98%. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 25g, 500g, 5g, 100g, 1g, 500mg, 10g, 250mg.
2,5-dichloropyridine-4-carboxylic acid (CAS 88912-26-9) is a chemical compound with the molecular formula C6H3Cl2NO2 and a molecular weight of 192.00 g/mol. IUPAC name: 2,5-dichloropyridine-4-carboxylic acid. InChIKey: GFOVTTQVBDEYPP-UHFFFAOYSA-N.
| Molecular formula | C6H3Cl2NO2 |
|---|---|
| Molecular weight | 192.00 g/mol |
| IUPAC name | 2,5-dichloropyridine-4-carboxylic acid |
| InChIKey | GFOVTTQVBDEYPP-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CN=C1Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)