cas: 851756-54-2 — see every product listed under this CAS number, including other names
2,6-Dichloro-3-methylphenylboronic Acid 98% (CAS 851756-54-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A867274-1g |
| cas | 851756-54-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 209.06 Pln | |
| Ambeed | 5g | 515.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A867274 |
(2,6-dichloro-3-methylphenyl)boronic acid (CAS 851756-54-2) is a chemical compound with the molecular formula C7H7BCl2O2 and a molecular weight of 204.85 g/mol. IUPAC name: (2,6-dichloro-3-methylphenyl)boronic acid. InChIKey: QRWVEDFFDGYSPO-UHFFFAOYSA-N.
| Molecular formula | C7H7BCl2O2 |
|---|---|
| Molecular weight | 204.85 g/mol |
| IUPAC name | (2,6-dichloro-3-methylphenyl)boronic acid |
| InChIKey | QRWVEDFFDGYSPO-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1Cl)C)Cl)(O)O |
Computed by PubChem (NCBI)