cas: 851756-54-2 — see every product listed under this CAS number, including other names
2,6–Dichloro–3–methylphenylboronic acid (contains varying amounts of Anhydride) (CAS 851756-54-2) is a chemical reagent available from Chemat. Available pack sizes: 100g, 1g, 25g, 5g. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GD10850-100g |
| cas | 851756-54-2 |
| size | 100g |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 100g | 3704.89 Pln | |
| GLPBio | 1g | 545.55 Pln | |
| GLPBio | 25g | 1561.22 Pln | |
| GLPBio | 5g | 681.29 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
(2,6-dichloro-3-methylphenyl)boronic acid (CAS 851756-54-2) is a chemical compound with the molecular formula C7H7BCl2O2 and a molecular weight of 204.85 g/mol. IUPAC name: (2,6-dichloro-3-methylphenyl)boronic acid. InChIKey: QRWVEDFFDGYSPO-UHFFFAOYSA-N.
| Molecular formula | C7H7BCl2O2 |
|---|---|
| Molecular weight | 204.85 g/mol |
| IUPAC name | (2,6-dichloro-3-methylphenyl)boronic acid |
| InChIKey | QRWVEDFFDGYSPO-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1Cl)C)Cl)(O)O |
Computed by PubChem (NCBI)