cas: 99479-66-0 — see every product listed under this CAS number, including other names
2,6-Dichloro-4-(Trifluoromethoxy)Aniline, 95%, 95% (CAS 99479-66-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114B6J-1g |
| cas | 99479-66-0 |
| size | 1g |
| availability | 190g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 98.00 Pln | |
| Chemat | 25g | 242.00 Pln | |
| Chemat | 100g | 779.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2,6-dichloro-4-(trifluoromethoxy)aniline (CAS 99479-66-0) is a chemical compound with the molecular formula C7H4Cl2F3NO and a molecular weight of 246.01 g/mol. IUPAC name: 2,6-dichloro-4-(trifluoromethoxy)aniline. InChIKey: FKISQWQHZULEEG-UHFFFAOYSA-N.
| Molecular formula | C7H4Cl2F3NO |
|---|---|
| Molecular weight | 246.01 g/mol |
| IUPAC name | 2,6-dichloro-4-(trifluoromethoxy)aniline |
| InChIKey | FKISQWQHZULEEG-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Cl)N)Cl)OC(F)(F)F |
Computed by PubChem (NCBI)