cas: 99479-66-0 — see every product listed under this CAS number, including other names
2,6-Dichloro-4-(trifluoromethoxy)aniline, 97% (CAS 99479-66-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F007843-1G |
| cas | 99479-66-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 102.07 Pln | |
| Fluorochem | 5g | 143.72 Pln | |
| Fluorochem | 10g | 232.23 Pln | |
| Fluorochem | 25g | 388.42 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
2,6-dichloro-4-(trifluoromethoxy)aniline (CAS 99479-66-0) is a chemical compound with the molecular formula C7H4Cl2F3NO and a molecular weight of 246.01 g/mol. IUPAC name: 2,6-dichloro-4-(trifluoromethoxy)aniline. InChIKey: FKISQWQHZULEEG-UHFFFAOYSA-N.
| Molecular formula | C7H4Cl2F3NO |
|---|---|
| Molecular weight | 246.01 g/mol |
| IUPAC name | 2,6-dichloro-4-(trifluoromethoxy)aniline |
| InChIKey | FKISQWQHZULEEG-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Cl)N)Cl)OC(F)(F)F |
Computed by PubChem (NCBI)