cas: 99479-66-0 — see every product listed under this CAS number, including other names
2,6-Dichloro-4-(trifluoromethoxy)aniline, >98.0%(GC) (CAS 99479-66-0) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | D3802-5G |
| cas | 99479-66-0 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 442.88 Pln | |
| TCI | 25g | 929.69 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC) |
2,6-dichloro-4-(trifluoromethoxy)aniline (CAS 99479-66-0) is a chemical compound with the molecular formula C7H4Cl2F3NO and a molecular weight of 246.01 g/mol. IUPAC name: 2,6-dichloro-4-(trifluoromethoxy)aniline. InChIKey: FKISQWQHZULEEG-UHFFFAOYSA-N.
| Molecular formula | C7H4Cl2F3NO |
|---|---|
| Molecular weight | 246.01 g/mol |
| IUPAC name | 2,6-dichloro-4-(trifluoromethoxy)aniline |
| InChIKey | FKISQWQHZULEEG-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Cl)N)Cl)OC(F)(F)F |
Computed by PubChem (NCBI)