cas: 1258298-05-3 — see every product listed under this CAS number, including other names
2,6-Dichloro-4-cyanobenzoic acid, 95% (CAS 1258298-05-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 100mg, 500mg. Offered by: Combi-blocks, Fluorochem, Ambeed, Chemat.
| brand | Combi-blocks |
|---|---|
| catalog number | QE-4896-250mg |
| cas | 1258298-05-3 |
| size | 250mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 250mg | price on request | |
| Combi-blocks | 1g | price on request | |
| Fluorochem | 1g | 2330.45 Pln | |
| Ambeed | 100mg | 398.19 Pln | |
| Ambeed | 250mg | 631.81 Pln | |
| Ambeed | 1g | 1232.56 Pln | |
| Chemat | 100mg | 299.60 Pln | |
| Chemat | 250mg | 467.60 Pln | |
| Chemat | 500mg | 750.80 Pln | |
| BLDpharm | 100mg | 425.43 Pln | |
| BLDpharm | 250mg | 675.34 Pln | |
| BLDpharm | 1g | 1325.11 Pln | |
| Fluorochem | 100mg | 539.41 Pln | |
| Fluorochem | 250mg | 851.80 Pln | |
| Fluorochem | 500mg | 1393.28 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
2,6-dichloro-4-cyanobenzoic acid (CAS 1258298-05-3) is a chemical compound with the molecular formula C8H3Cl2NO2 and a molecular weight of 216.02 g/mol. IUPAC name: 2,6-dichloro-4-cyanobenzoic acid. InChIKey: RABGVNSIHQKYAS-UHFFFAOYSA-N.
| Molecular formula | C8H3Cl2NO2 |
|---|---|
| Molecular weight | 216.02 g/mol |
| IUPAC name | 2,6-dichloro-4-cyanobenzoic acid |
| InChIKey | RABGVNSIHQKYAS-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Cl)C(=O)O)Cl)C#N |
Computed by PubChem (NCBI)