cas: 1258298-05-3 — see every product listed under this CAS number, including other names
2,6-Dichloro-4-cyanobenzoic acid, 97% (CAS 1258298-05-3) is a chemical reagent available from Chemat. Available pack sizes: 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A325952-10g |
| cas | 1258298-05-3 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 10069.36 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
2,6-dichloro-4-cyanobenzoic acid (CAS 1258298-05-3) is a chemical compound with the molecular formula C8H3Cl2NO2 and a molecular weight of 216.02 g/mol. IUPAC name: 2,6-dichloro-4-cyanobenzoic acid. InChIKey: RABGVNSIHQKYAS-UHFFFAOYSA-N.
| Molecular formula | C8H3Cl2NO2 |
|---|---|
| Molecular weight | 216.02 g/mol |
| IUPAC name | 2,6-dichloro-4-cyanobenzoic acid |
| InChIKey | RABGVNSIHQKYAS-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Cl)C(=O)O)Cl)C#N |
Computed by PubChem (NCBI)