cas: 1182709-86-9 — see every product listed under this CAS number, including other names
2,6-Dichloro-4-fluorobenzaldehyde, 98%, 98% (CAS 1182709-86-9) is a chemical reagent available from Chemat. Available pack sizes: 50g, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114G3V-50g |
| cas | 1182709-86-9 |
| size | 50g |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50g | 1370.00 Pln | |
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 122.00 Pln | |
| Chemat | 5g | 328.40 Pln | |
| Chemat | 10g | 477.20 Pln | |
| Chemat | 25g | 818.00 Pln | |
| Chemat | 100g | 2651.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2,6-dichloro-4-fluorobenzaldehyde (CAS 1182709-86-9) is a chemical compound with the molecular formula C7H3Cl2FO and a molecular weight of 193.00 g/mol. IUPAC name: 2,6-dichloro-4-fluorobenzaldehyde. InChIKey: UOQMGQYMDHYXTB-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2FO |
|---|---|
| Molecular weight | 193.00 g/mol |
| IUPAC name | 2,6-dichloro-4-fluorobenzaldehyde |
| InChIKey | UOQMGQYMDHYXTB-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Cl)C=O)Cl)F |
Computed by PubChem (NCBI)