cas: 82671-06-5 — see every product listed under this CAS number, including other names
2,6-Dichloro-5-fluoropyridine-3-carboxylic acid, 98%, 98% (CAS 82671-06-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g, 1kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114G45-1g |
| cas | 82671-06-5 |
| size | 1g |
| availability | 7000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 69.20 Pln | |
| Chemat | 5g | 74.00 Pln | |
| Chemat | 10g | 74.00 Pln | |
| Chemat | 25g | 83.60 Pln | |
| Chemat | 100g | 165.20 Pln | |
| Chemat | 500g | 633.60 Pln | |
| Chemat | 1kg | 1187.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2,6-dichloro-5-fluoropyridine-3-carboxylic acid (CAS 82671-06-5) is a chemical compound with the molecular formula C6H2Cl2FNO2 and a molecular weight of 209.99 g/mol. IUPAC name: 2,6-dichloro-5-fluoropyridine-3-carboxylic acid. InChIKey: LTDGKGCHRNNCAC-UHFFFAOYSA-N.
| Molecular formula | C6H2Cl2FNO2 |
|---|---|
| Molecular weight | 209.99 g/mol |
| IUPAC name | 2,6-dichloro-5-fluoropyridine-3-carboxylic acid |
| InChIKey | LTDGKGCHRNNCAC-UHFFFAOYSA-N |
| SMILES | C1=C(C(=NC(=C1F)Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)