CAS 55776-17-5 appears in our catalog under these names: 2,6-Dimethoxy-3-nitrobenzoic acid, 95%, 2,6-Dimethoxy-3-nitrobenzoic acid, 97% , 2,6-Dimethoxy-3-nitrobenzoic acid, 2,6-Dimethoxy-3-nitrobenzoic acid, 95%(GC-MS),RG, 95%(GC-MS),RG, 2,6-Dimethoxy-3-nitrobenzoic acid, 95%(GC-MS),RG. Offered by: Combi-blocks, Thermo Scientific (Alfa Aesar), Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 5g, 10g, 250mg.
2,6-dimethoxy-3-nitrobenzoic acid (CAS 55776-17-5) is a chemical compound with the molecular formula C9H9NO6 and a molecular weight of 227.17 g/mol. IUPAC name: 2,6-dimethoxy-3-nitrobenzoic acid. InChIKey: YIKBQFPTPKEFSM-UHFFFAOYSA-N.
| Molecular formula | C9H9NO6 |
|---|---|
| Molecular weight | 227.17 g/mol |
| IUPAC name | 2,6-dimethoxy-3-nitrobenzoic acid |
| InChIKey | YIKBQFPTPKEFSM-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)[N+](=O)[O-])OC)C(=O)O |
Computed by PubChem (NCBI)