Products 91004-48-7
CAS 91004-48-7 appears in our catalog under these names: 3,4-Dimethoxy-5-nitrobenzoic acid, 95%, 3，4–Dimethoxy–5–nitrobenzoic acid, 3,4-dimethoxy-5-nitrobenzoic acid, 3,4-Dimethoxy-5-nitrobenzoic acid 97%, 3,4-Dimethoxy-5-nitrobenzoic acid, 98%, 98%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 250mg, 1g, 100mg, 10g, 5g.
3,4-dimethoxy-5-nitrobenzoic acid (CAS 91004-48-7) is a chemical compound with the molecular formula C9H9NO6 and a molecular weight of 227.17 g/mol. IUPAC name: 3,4-dimethoxy-5-nitrobenzoic acid. InChIKey: GQNSKXYALDGGGN-UHFFFAOYSA-N.
| Molecular formula | C9H9NO6 |
|---|---|
| Molecular weight | 227.17 g/mol |
| IUPAC name | 3,4-dimethoxy-5-nitrobenzoic acid |
| InChIKey | GQNSKXYALDGGGN-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1OC)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
3,4-dimethoxy-5-nitrobenzoic acid, 3,4-dimethoxy-5-nitrobenzoicacid, GQNSKXYALDGGGN-UHFFFAOYSA-N, 3-nitro-4,5-dimethoxybenzoic acid, Benzoic acid,3,4-dimethoxy-5-nitro-, Benzoic acid, 3,4-dimethoxy-5-nitro-, 3,4-dimethoxy-5-nitrobenzoic acid(WXC04825), 3,4-dimethoxy-5-nitrobenzoic acid (innovative process)