Products 17894-26-7
CAS 17894-26-7 appears in our catalog under these names: 2,5-Dimethoxy-3-nitrobenzoic acid, 98%, 2，5–Dimethoxy–3–nitrobenzoic Acid, 2,5-Dimethoxy-3-nitrobenzoic acid, 2,5-Dimethoxy-3-nitrobenzoic Acid, >98.0%(GC)(T), 2,5-Dimethoxy-3-nitrobenzoic acid, 98.0%, 98.0%. Offered by: Combi-blocks, GLPBio, Biosynth, TCI, Chemat. Available pack sizes: 1g, 200mg, 1000mg, 500mg, 2000mg.
2,5-dimethoxy-3-nitrobenzoic acid (CAS 17894-26-7) is a chemical compound with the molecular formula C9H9NO6 and a molecular weight of 227.17 g/mol. IUPAC name: 2,5-dimethoxy-3-nitrobenzoic acid. InChIKey: QCJROOYLFVYZEP-UHFFFAOYSA-N.
| Molecular formula | C9H9NO6 |
|---|---|
| Molecular weight | 227.17 g/mol |
| IUPAC name | 2,5-dimethoxy-3-nitrobenzoic acid |
| InChIKey | QCJROOYLFVYZEP-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C(=C1)[N+](=O)[O-])OC)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
2,5-Dimethoxy-3-nitrobenzoic acid, 2,5-Dimethoxy-3-nitro benzoic acid, Benzoic acid, 2,5-dimethoxy-3-nitro-, 2,5-Dimethoxy-3-nitrobenzoicAcid, 2,5-dimethoxy-3-nitro-benzoic Acid, QCJROOYLFVYZEP-UHFFFAOYSA-N, 2,5-Dimethoxy-3-nitrobenzoic acid, 99%, InChI=1/C9H9NO6/c1-15-5-3-6(9(11)12)8(16-2)7(4-5)10(13)14/h3-4H,1-2H3,(H,11,12