Products 90564-41-3
CAS 90564-41-3 appears in our catalog under these names: 2,4-Dimethoxy-5-nitrobenzoic acid, 98%, 2,4-Dimethoxy-5-nitrobenzoic acid, 95-<97%, 2,4-Dimethoxy-5-nitrobenzoic acid, ≥97-<99%, 2，4–diMethoxy–5–nitrobenzoic acid, 2，4-diMethoxy-5-nitrobenzoic acid, 95%, 95%. Offered by: Combi-blocks, Hoffman Fine Chemicals, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g, 250mg, 50mg.
2,4-dimethoxy-5-nitrobenzoic acid (CAS 90564-41-3) is a chemical compound with the molecular formula C9H9NO6 and a molecular weight of 227.17 g/mol. IUPAC name: 2,4-dimethoxy-5-nitrobenzoic acid. InChIKey: RECRLCHPXXOYHZ-UHFFFAOYSA-N.
| Molecular formula | C9H9NO6 |
|---|---|
| Molecular weight | 227.17 g/mol |
| IUPAC name | 2,4-dimethoxy-5-nitrobenzoic acid |
| InChIKey | RECRLCHPXXOYHZ-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1C(=O)O)[N+](=O)[O-])OC |
Computed by PubChem (NCBI)