CAS 27883-60-9 appears in our catalog under these names: 4-Hydroxy-5-methoxy-2-nitro-benzoic acid methyl ester, 97%, Methyl 4–hydroxy–5–methoxy–2–nitrobenzoate, Methyl 4-hydroxy-5-methoxy-2-nitrobenzoate 97%, Methyl 4-hydroxy-5-methoxy-2-nitrobenzoate, 97%, 97%, 4-Hydroxy-5-methoxy-2-nitro-benzoic acid methyl ester, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 100g, 10g, 1g, 250mg, 100mg.
Methyl 4-hydroxy-5-methoxy-2-nitrobenzoate (CAS 27883-60-9) is a chemical compound with the molecular formula C9H9NO6 and a molecular weight of 227.17 g/mol. IUPAC name: methyl 4-hydroxy-5-methoxy-2-nitrobenzoate. InChIKey: SKKNLIAUOSEGNQ-UHFFFAOYSA-N.
| Molecular formula | C9H9NO6 |
|---|---|
| Molecular weight | 227.17 g/mol |
| IUPAC name | methyl 4-hydroxy-5-methoxy-2-nitrobenzoate |
| InChIKey | SKKNLIAUOSEGNQ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)C(=O)OC)[N+](=O)[O-])O |
Computed by PubChem (NCBI)