Products 1261587-17-0

CAS 1261587-17-0 is the registry number for 2-Hydroxy-2-(4-methoxy-2-nitrophenyl)acetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-hydroxy-2-(4-methoxy-2-nitrophenyl)acetic acid (CAS 1261587-17-0) is a chemical compound with the molecular formula C9H9NO6 and a molecular weight of 227.17 g/mol. IUPAC name: 2-hydroxy-2-(4-methoxy-2-nitrophenyl)acetic acid. InChIKey: OQXRXXUOJOZBSW-UHFFFAOYSA-N.

Identity
Molecular formulaC9H9NO6
Molecular weight227.17 g/mol
IUPAC name2-hydroxy-2-(4-methoxy-2-nitrophenyl)acetic acid
InChIKeyOQXRXXUOJOZBSW-UHFFFAOYSA-N
SMILESCOC1=CC(=C(C=C1)C(C(=O)O)O)[N+](=O)[O-]

Computed by PubChem (NCBI)