2,6-Dimethoxynaphthalene, 98%
cas: 5486-55-5 — see every product listed under this CAS number, including other names
2,6-Dimethoxynaphthalene, 98% (CAS 5486-55-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g, 250mg. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A443071-1g |
| cas | 5486-55-5 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 225.75 Pln | |
| Ambeed | 10g | 359.25 Pln | |
| Ambeed | 25g | 698.56 Pln | |
| Ambeed | 100g | 2473.00 Pln | |
| Ambeed | 500g | 12073.88 Pln | |
| BLDpharm | 250mg | 125.54 Pln | |
| BLDpharm | 1g | 136.64 Pln | |
| BLDpharm | 5g | 236.61 Pln | |
| BLDpharm | 10g | 386.56 Pln | |
| BLDpharm | 25g | 747.54 Pln | |
| BLDpharm | 100g | 2657.98 Pln | |
| BLDpharm | 500g | 13009.89 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
2,6-dimethoxynaphthalene (CAS 5486-55-5) is a chemical compound with the molecular formula C12H12O2 and a molecular weight of 188.22 g/mol. IUPAC name: 2,6-dimethoxynaphthalene. InChIKey: AHKDVDYNDXGFPP-UHFFFAOYSA-N.
| Molecular formula | C12H12O2 |
|---|---|
| Molecular weight | 188.22 g/mol |
| IUPAC name | 2,6-dimethoxynaphthalene |
| InChIKey | AHKDVDYNDXGFPP-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)C=C(C=C2)OC |
Computed by PubChem (NCBI)