CAS 5486-55-5 appears in our catalog under these names: 2,6-Dimethoxynaphthalene, 95%, 2,6–Dimethoxynaphthalene, 2,6-Dimethoxynaphthalene, 99% , 2,6-Dimethoxynaphthalene, 2,6-Dimethoxynaphthalene, >98.0%(GC). Offered by: Combi-blocks, GLPBio, Thermo Scientific (Alfa Aesar), Biosynth, TCI. Available pack sizes: 1g, 10g, 25g, 100g, 5g, 50g, 500g, 250mg.
2,6-dimethoxynaphthalene (CAS 5486-55-5) is a chemical compound with the molecular formula C12H12O2 and a molecular weight of 188.22 g/mol. IUPAC name: 2,6-dimethoxynaphthalene. InChIKey: AHKDVDYNDXGFPP-UHFFFAOYSA-N.
| Molecular formula | C12H12O2 |
|---|---|
| Molecular weight | 188.22 g/mol |
| IUPAC name | 2,6-dimethoxynaphthalene |
| InChIKey | AHKDVDYNDXGFPP-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)C=C(C=C2)OC |
Computed by PubChem (NCBI)