cas: 610261-45-5 — see every product listed under this CAS number, including other names
2,6-Dimethyl-quinoline-3-carboxylic acid (CAS 610261-45-5) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F059313-1G |
| cas | 610261-45-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 2517.88 Pln |
| delivery time | 2-3 weeks |
|---|
2,6-dimethylquinoline-3-carboxylic acid (CAS 610261-45-5) is a chemical compound with the molecular formula C12H11NO2 and a molecular weight of 201.22 g/mol. IUPAC name: 2,6-dimethylquinoline-3-carboxylic acid. InChIKey: HCAIPPMINDHAHV-UHFFFAOYSA-N.
| Molecular formula | C12H11NO2 |
|---|---|
| Molecular weight | 201.22 g/mol |
| IUPAC name | 2,6-dimethylquinoline-3-carboxylic acid |
| InChIKey | HCAIPPMINDHAHV-UHFFFAOYSA-N |
| SMILES | CC1=CC2=CC(=C(N=C2C=C1)C)C(=O)O |
Computed by PubChem (NCBI)