CAS 35889-87-3 is the registry number for Benzyl 1H-pyrrole-2-carboxylate, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 5g, 1g.
Benzyl 1H-pyrrole-2-carboxylate (CAS 35889-87-3) is a chemical compound with the molecular formula C12H11NO2 and a molecular weight of 201.22 g/mol. IUPAC name: benzyl 1H-pyrrole-2-carboxylate. InChIKey: XTKILPAAGBOZHY-UHFFFAOYSA-N.
| Molecular formula | C12H11NO2 |
|---|---|
| Molecular weight | 201.22 g/mol |
| IUPAC name | benzyl 1H-pyrrole-2-carboxylate |
| InChIKey | XTKILPAAGBOZHY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)C2=CC=CN2 |
Computed by PubChem (NCBI)